kingken4278 kingken4278

03-02-2020
Biology

contestada

What is the human embryo called after the eighth week of development?

Respuesta :

saradhatalip saradhatalip

03-02-2020

Answer:

fter 8 weeks of pregnancy it's called the fetus

Answer Link

madds2005 madds2005

03-02-2020

After 8 weeks of devleopnment it is called the fetus

Answer Link

Otras preguntas

What is the slope-intercept form of the equation of a line that passes through (5, -4) and has a slope of 3/4?

Calculate the annual return percentage

Solve the linear equation: 3.4 + 2(9.7 – 4.8x) = 61.2 What are the possible steps involved in solving this equation? Check all that apply. Add 3.4 and 2. Dis

The value of x + x(xx) when x = 2 is: (a) 10, (b) 16, (c) 18, (d) 36, (e) 64

what kind of net charge do batterys have

In the research model, the step in which the researcher specifies what he or she wants to learn about a specific topic of study is called ________

Create a stem-and-leaf plot of the data values 72,44,75,57,81,65,68,72,73,84,91,76,83,88.

How does melting point compare among molecular compounds and ionic compounds?

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

simplify in exponential notation 2(a)(b)(a)(b)