raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

Which was not a cause of the gradual decline and fall of the Western Roman Empire? the spread of Christianity economic hardships for Rome''s citizens invading b
The whole is 8. One part is 8. What is the other part? Tell how you know.
What does the Bill of Rights list, and why was it an important part of getting the Constitution approved?
find the value of x and yz if y is between x and z xy=12, yz=2x, and xz=28
the invisible line at 0 degrees longitude is called
how do you write one and twelve hundredths in 2 other forms
explain why is it important to line up decimals numbers by their place value when you add or subtract them
Annie traveled 5 times the sum of the number of hours Brian traveled and 2. together they traveled 20 hours. find the number of hours each person worked.
what issue united the republican party?
Which are accurate descriptions of the English colonies in North America? Choose all answers that are correct. A. Unlike farmers in other colonies, Virginia pl